|
CAS#: 6807-96-1 Product: Versicolorin A No suppilers available for the product. |
| Name | Versicolorin A |
|---|---|
| Synonyms | Nsc274542; Versicolorin; Anthra(2,3-B)Furo(3,2-D)Furan-5,10-Dione, 3A,12A-Dihydro-4,6,8-Trihydroxy-, Z-(-)- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H10O7 |
| Molecular Weight | 338.27 |
| CAS Registry Number | 6807-96-1 |
| SMILES | C3=C2OC1OC=CC1C2=C(O)C4=C3C(=O)C5=C(C4=O)C(=CC(=C5)O)O |
| InChI | 1S/C18H10O7/c19-6-3-8-12(10(20)4-6)16(22)14-9(15(8)21)5-11-13(17(14)23)7-1-2-24-18(7)25-11/h1-5,7,18-20,23H |
| InChIKey | SJNDYXPJRUTLNW-UHFFFAOYSA-N |
| Density | 1.752g/cm3 (Cal.) |
|---|---|
| Boiling point | 613.997°C at 760 mmHg (Cal.) |
| Flash point | 232.988°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Versicolorin A |