|
CAS#: 68084-62-8 Product: 2-[Methyl[(Pentadecafluoroheptyl)Sulphonyl]Amino]Ethyl Acrylate No suppilers available for the product. |
| Name | 2-[Methyl[(Pentadecafluoroheptyl)Sulphonyl]Amino]Ethyl Acrylate |
|---|---|
| Synonyms | Prop-2-Enoic Acid 2-(Methyl-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoroheptylsulfonyl)Amino)Ethyl Ester; Acrylic Acid 2-(Methyl-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoroheptylsulfonyl)Amino)Ethyl Ester; 2-Propenoic Acid, 2-(Methyl((Pentadecafluoroheptyl)Sulfonyl)Amino)Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10F15NO4S |
| Molecular Weight | 561.26 |
| CAS Registry Number | 68084-62-8 |
| EINECS | 268-448-1 |
| SMILES | C(N([S](=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C)COC(=O)C=C |
| InChI | 1S/C13H10F15NO4S/c1-3-6(30)33-5-4-29(2)34(31,32)13(27,28)11(22,23)9(18,19)7(14,15)8(16,17)10(20,21)12(24,25)26/h3H,1,4-5H2,2H3 |
| InChIKey | BEYGZFVOTUDDJK-UHFFFAOYSA-N |
| Density | 1.594g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.119°C at 760 mmHg (Cal.) |
| Flash point | 157.079°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[Methyl[(Pentadecafluoroheptyl)Sulphonyl]Amino]Ethyl Acrylate |