|
CAS#: 6812-88-0 Product: 7-O-Acetylhorminone No suppilers available for the product. |
| Name | 7-O-Acetylhorminone |
|---|---|
| Synonyms | (8-Hydroxy-7-Isopropyl-1,1,4A-Trimethyl-5,6-Dioxo-2,3,4,9,10,10A-Hexahydrophenanthren-9-Yl) Acetate; Acetic Acid (8-Hydroxy-7-Isopropyl-1,1,4A-Trimethyl-5,6-Dioxo-2,3,4,9,10,10A-Hexahydrophenanthren-9-Yl) Ester; Acetic Acid (8-Hydroxy-7-Isopropyl-5,6-Diketo-1,1,4A-Trimethyl-2,3,4,9,10,10A-Hexahydrophenanthren-9-Yl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 |
| CAS Registry Number | 6812-88-0 |
| SMILES | CC12C(C(CCC1)(C)C)CC(OC(=O)C)C3=C2C(=O)C(=O)C(=C3O)C(C)C |
| InChI | 1S/C22H30O5/c1-11(2)15-18(24)16-13(27-12(3)23)10-14-21(4,5)8-7-9-22(14,6)17(16)20(26)19(15)25/h11,13-14,24H,7-10H2,1-6H3 |
| InChIKey | MNEJUZVNGNCLJU-UHFFFAOYSA-N |
| Density | 1.183g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.587°C at 760 mmHg (Cal.) |
| Flash point | 154.076°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-O-Acetylhorminone |