Online Database of Chemicals from Around the World
|
CAS#: 68123-28-4 Product: 4-Chloro-4-Methyl-1,3-Dioxa-2-Thia-4-Silacycloheptane 2,2-Dioxide No suppilers available for the product. |
| Name | 4-Chloro-4-Methyl-1,3-Dioxa-2-Thia-4-Silacycloheptane 2,2-Dioxide |
|---|---|
| Synonyms | 1,3-Dioxa-2-Thia-4-Silacycloheptane, 4-Chloro-4-Methyl-, 2,2-Dioxide; 1-Methyl-1-Chloro-6,6-Dioxo-1-Sila-5,7-Dioxa-6-Thiacycloheptane |
| Molecular Structure |  |
| Molecular Formula | C4H9ClO4SSi |
| Molecular Weight | 216.71 |
| CAS Registry Number | 68123-28-4 |
| EINECS | 268-545-9 |
| SMILES | C[Si]1(Cl)O[S](=O)(=O)OCCC1 |
| InChI | 1S/C4H9ClO4SSi/c1-11(5)4-2-3-8-10(6,7)9-11/h2-4H2,1H3 |
| InChIKey | ZSGSKCKHOVFCJP-UHFFFAOYSA-N |
| Density | 1.386g/cm3 (Cal.) |
|---|---|
| Boiling point | 225.481°C at 760 mmHg (Cal.) |
| Flash point | 90.168°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-4-Methyl-1,3-Dioxa-2-Thia-4-Silacycloheptane 2,2-Dioxide |