|
CAS#: 68140-51-2 Product: 2-(2,6-Dimethylhepta-1,5-Dienyl)-4,5-Dimethyl-1,3-Dioxolane No suppilers available for the product. |
| Name | 2-(2,6-Dimethylhepta-1,5-Dienyl)-4,5-Dimethyl-1,3-Dioxolane |
|---|---|
| Synonyms | 1,3-Dioxolane, 2-(2,6-Dimethyl-1,5-Heptadienyl)-4,5-Dimethyl-; Nsc58649 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 |
| CAS Registry Number | 68140-51-2 |
| EINECS | 268-803-0 |
| SMILES | C(\C(=C/C1OC(C(O1)C)C)C)CC=C(C)C |
| InChI | 1S/C14H24O2/c1-10(2)7-6-8-11(3)9-14-15-12(4)13(5)16-14/h7,9,12-14H,6,8H2,1-5H3/b11-9- |
| InChIKey | XPCRVJQZWNHAQD-LUAWRHEFSA-N |
| Density | 0.939g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.642°C at 760 mmHg (Cal.) |
| Flash point | 127.505°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,6-Dimethylhepta-1,5-Dienyl)-4,5-Dimethyl-1,3-Dioxolane |