|
CAS#: 68141-21-9 Product: alpha-Isobutylbenzyl Acetate No suppilers available for the product. |
| Name | alpha-Isobutylbenzyl Acetate |
|---|---|
| Synonyms | (3-Methyl-1-Phenyl-Butyl) Acetate; Acetic Acid (3-Methyl-1-Phenylbutyl) Ester; Acetic Acid (3-Methyl-1-Phenyl-Butyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 |
| CAS Registry Number | 68141-21-9 |
| EINECS | 268-843-9 |
| SMILES | C1=CC=C(C=C1)C(OC(=O)C)CC(C)C |
| InChI | 1S/C13H18O2/c1-10(2)9-13(15-11(3)14)12-7-5-4-6-8-12/h4-8,10,13H,9H2,1-3H3 |
| InChIKey | PJHMVQZEQHALNW-UHFFFAOYSA-N |
| Density | 0.985g/cm3 (Cal.) |
|---|---|
| Boiling point | 262.002°C at 760 mmHg (Cal.) |
| Flash point | 94.458°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Isobutylbenzyl Acetate |