|
CAS#: 6815-42-5 Product: 4-Chloro-2-Nitro-m-Cresol No suppilers available for the product. |
| Name | 4-Chloro-2-Nitro-m-Cresol |
|---|---|
| Synonyms | 4-Chloro-3-Methyl-2-Nitro-Phenol; M-Cresol, 4-Chloro-2(Or 6)-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6ClNO3 |
| Molecular Weight | 187.58 |
| CAS Registry Number | 6815-42-5 |
| EINECS | 229-890-0 |
| SMILES | C1=CC(=C(C(=C1O)[N+]([O-])=O)C)Cl |
| InChI | 1S/C7H6ClNO3/c1-4-5(8)2-3-6(10)7(4)9(11)12/h2-3,10H,1H3 |
| InChIKey | CPLAVZOCFVGOGO-UHFFFAOYSA-N |
| Density | 1.466g/cm3 (Cal.) |
|---|---|
| Boiling point | 256.194°C at 760 mmHg (Cal.) |
| Flash point | 108.743°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-2-Nitro-m-Cresol |