|
CAS#: 68186-32-3 Product: 1,2,4-Benzenetricarboxylic Acid, Isooctyl Ester No suppilers available for the product. |
| Name | 1,2,4-Benzenetricarboxylic Acid, Isooctyl Ester |
|---|---|
| Synonyms | 6-Methylheptan-1-Ol; Trimellitic Acid; Trimellitic Anhydride, Isooctyl Alcohol Ester; 1,2,4-Benzenetricarboxylic Acid, Isooctyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C17H24O7 |
| Molecular Weight | 340.37 |
| CAS Registry Number | 68186-32-3 |
| EINECS | 269-038-5 |
| SMILES | C1=C(C=CC(=C1C(=O)O)C(=O)O)C(=O)O.C(C(C)C)CCCCO |
| InChI | 1S/C9H6O6.C8H18O/c10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15;1-8(2)6-4-3-5-7-9/h1-3H,(H,10,11)(H,12,13)(H,14,15);8-9H,3-7H2,1-2H3 |
| InChIKey | DAQNBKRYDLKJMJ-UHFFFAOYSA-N |
| Boiling point | 505.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 273.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,4-Benzenetricarboxylic Acid, Isooctyl Ester |