|
CAS#: 68189-19-5 Product: 4-(1,1-Dimethylethyl)-2,3-Dimethylphenol No suppilers available for the product. |
| Name | 4-(1,1-Dimethylethyl)-2,3-Dimethylphenol |
|---|---|
| Synonyms | 4-Tert-Butyl-2,3-Dimethyl-Phenol; Phenol, 4-(1,1-Dimethylethyl)-2,3-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 |
| CAS Registry Number | 68189-19-5 |
| SMILES | C1=CC(=C(C(=C1O)C)C)C(C)(C)C |
| InChI | 1S/C12H18O/c1-8-9(2)11(13)7-6-10(8)12(3,4)5/h6-7,13H,1-5H3 |
| InChIKey | OXPSEZLCVXHNQE-UHFFFAOYSA-N |
| Density | 0.953g/cm3 (Cal.) |
|---|---|
| Boiling point | 258.999°C at 760 mmHg (Cal.) |
| Flash point | 120.144°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(1,1-Dimethylethyl)-2,3-Dimethylphenol |