|
CAS#: 68201-82-1 Product: 3,5,5-Trimethylhexanoic Acid, Iron(2+) Iron(3+) Salt No suppilers available for the product. |
| Name | 3,5,5-Trimethylhexanoic Acid, Iron(2+) Iron(3+) Salt |
|---|---|
| Synonyms | 3,5,5-Trimethylhexanoic Acid, Iron(2+) Iron(3+) Salt; Hexanoic Acid, 3,5,5-Trimethyl-, Iron(2+) Iron(3+) Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C11H26O2 |
| Molecular Weight | 190.33 |
| CAS Registry Number | 68201-82-1 |
| EINECS | 269-241-9 |
| SMILES | C.C(C(C)(C)C)C(CC(O)=O)C.C |
| InChI | 1S/C9H18O2.2CH4/c1-7(5-8(10)11)6-9(2,3)4;;/h7H,5-6H2,1-4H3,(H,10,11);2*1H4 |
| InChIKey | USXHQLPNVRKLJI-UHFFFAOYSA-N |
| Boiling point | 243.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 109.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5,5-Trimethylhexanoic Acid, Iron(2+) Iron(3+) Salt |