|
CAS#: 68213-94-5 Product: 1-Amino-8-[(2,4-Dibromophenyl)Amino]-4,5-Dihydroxyanthraquinone No suppilers available for the product. |
| Name | 1-Amino-8-[(2,4-Dibromophenyl)Amino]-4,5-Dihydroxyanthraquinone |
|---|---|
| Synonyms | 1-Amino-8-[(2,4-Dibromophenyl)Amino]-4,5-Dihydroxy-Anthracene-9,10-Dione; 1-Amino-8-[(2,4-Dibromophenyl)Amino]-4,5-Dihydroxy-9,10-Anthraquinone; 1-Amino-8-((2,4-Dibromophenyl)Amino)-4,5-Dihydroxyanthraquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C20H12Br2N2O4 |
| Molecular Weight | 504.13 |
| CAS Registry Number | 68213-94-5 |
| EINECS | 269-277-5 |
| SMILES | C1=C(Br)C(=CC=C1Br)NC4=C3C(=O)C2=C(C(=CC=C2N)O)C(C3=C(C=C4)O)=O |
| InChI | 1S/C20H12Br2N2O4/c21-8-1-3-11(9(22)7-8)24-12-4-6-14(26)18-16(12)19(27)15-10(23)2-5-13(25)17(15)20(18)28/h1-7,24-26H,23H2 |
| InChIKey | BSAIZSQXJWMWFM-UHFFFAOYSA-N |
| Density | 1.965g/cm3 (Cal.) |
|---|---|
| Boiling point | 649.339°C at 760 mmHg (Cal.) |
| Flash point | 346.508°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Amino-8-[(2,4-Dibromophenyl)Amino]-4,5-Dihydroxyanthraquinone |