|
CAS#: 68214-66-4 Product: 2-Ethoxyethyl [2-[(2-Chloro-4-Nitrophenyl)Azo]-5-(Diethylamino)Phenyl]Carbamate No suppilers available for the product. |
| Name | 2-Ethoxyethyl [2-[(2-Chloro-4-Nitrophenyl)Azo]-5-(Diethylamino)Phenyl]Carbamate |
|---|---|
| Synonyms | 2-Ethoxyethyl N-[2-(2-Chloro-4-Nitro-Phenyl)Azo-5-Diethylamino-Phenyl]Carbamate; N-[2-(2-Chloro-4-Nitrophenyl)Azo-5-Diethylaminophenyl]Carbamic Acid 2-Ethoxyethyl Ester; N-[2-(2-Chloro-4-Nitro-Phenyl)Azo-5-Diethylamino-Phenyl]Carbamic Acid 2-Ethoxyethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C21H26ClN5O5 |
| Molecular Weight | 463.92 |
| CAS Registry Number | 68214-66-4 |
| EINECS | 269-308-2 |
| SMILES | C1=C(C=CC(=C1Cl)N=NC2=C(C=C(C=C2)N(CC)CC)NC(=O)OCCOCC)[N+]([O-])=O |
| InChI | 1S/C21H26ClN5O5/c1-4-26(5-2)15-7-10-19(20(14-15)23-21(28)32-12-11-31-6-3)25-24-18-9-8-16(27(29)30)13-17(18)22/h7-10,13-14H,4-6,11-12H2,1-3H3,(H,23,28) |
| InChIKey | BASKGNLLUQTLND-UHFFFAOYSA-N |
| Density | 1.287g/cm3 (Cal.) |
|---|---|
| Boiling point | 585.448°C at 760 mmHg (Cal.) |
| Flash point | 307.868°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethoxyethyl [2-[(2-Chloro-4-Nitrophenyl)Azo]-5-(Diethylamino)Phenyl]Carbamate |