|
CAS#: 68226-94-8 Product: Dirubidium 4,4'-Methylenebis[3-Hydroxy-2-Naphthoate] No suppilers available for the product. |
| Name | Dirubidium 4,4'-Methylenebis[3-Hydroxy-2-Naphthoate] |
|---|---|
| Synonyms | 4-[(3-Carboxylato-2-Hydroxy-1-Naphthyl)Methyl]-3-Hydroxy-Naphthalene-2-Carboxylate; Rubidium(+1) Cation; 4-[(3-Carboxylato-2-Hydroxy-1-Naphthyl)Methyl]-3-Hydroxy-2-Naphthalenecarboxylate; Rubidium(+1) Cation; 4-[(3-Carboxylato-2-Hydroxy-1-Naphthyl)Methyl]-3-Hydroxy-2-Naphthoate; Rubidium(+1) Cation |
| Molecular Structure | ![]() |
| Molecular Formula | C23H14O6Rb2 |
| Molecular Weight | 557.30 |
| CAS Registry Number | 68226-94-8 |
| EINECS | 269-332-3 |
| SMILES | C(C1=C2C(=CC(=C1O)C([O-])=O)C=CC=C2)C3=C(O)C(=CC4=CC=CC=C34)C([O-])=O.[Rb+].[Rb+] |
| InChI | 1S/C23H16O6.2Rb/c24-20-16(14-7-3-1-5-12(14)9-18(20)22(26)27)11-17-15-8-4-2-6-13(15)10-19(21(17)25)23(28)29;;/h1-10,24-25H,11H2,(H,26,27)(H,28,29);;/q;2*+1/p-2 |
| InChIKey | ZEVADHLYTIQGRA-UHFFFAOYSA-L |
| Boiling point | 642.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 356.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dirubidium 4,4'-Methylenebis[3-Hydroxy-2-Naphthoate] |