|
CAS#: 68228-19-3 Product: 2-[(4-Chloro-6-Ethylamino-1,3,5-Triazin-2-Yl)Amino]Acetic Acid No suppilers available for the product. |
| Name | 2-[(4-Chloro-6-Ethylamino-1,3,5-Triazin-2-Yl)Amino]Acetic Acid |
|---|---|
| Synonyms | 2-[(4-Chloro-6-Ethylamino-S-Triazin-2-Yl)Amino]Acetic Acid; 2-[(4-Chloro-6-Ethylamino-1,3,5-Triazin-2-Yl)Amino]Ethanoic Acid; N-(4-Chloro-6-(Ethylamino)-S-Triazin-2-Yl)Glycine (8Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C7H10ClN5O2 |
| Molecular Weight | 231.64 |
| CAS Registry Number | 68228-19-3 |
| SMILES | C(NC1=NC(=NC(=N1)NCC(=O)O)Cl)C |
| InChI | 1S/C7H10ClN5O2/c1-2-9-6-11-5(8)12-7(13-6)10-3-4(14)15/h2-3H2,1H3,(H,14,15)(H2,9,10,11,12,13) |
| InChIKey | IAUFMJOLSFEAIJ-UHFFFAOYSA-N |
| Density | 1.569g/cm3 (Cal.) |
|---|---|
| Boiling point | 499.285°C at 760 mmHg (Cal.) |
| Flash point | 255.759°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(4-Chloro-6-Ethylamino-1,3,5-Triazin-2-Yl)Amino]Acetic Acid |