|
CAS#: 68228-20-6 Product: N-[4-Chloro-6-(isopropylamino)-1,3,5-triazin-2-yl]glycine No suppilers available for the product. |
| Name | N-[4-Chloro-6-(isopropylamino)-1,3,5-triazin-2-yl]glycine |
|---|---|
| Synonyms | proglinazine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12ClN5O2 |
| Molecular Weight | 245.67 |
| CAS Registry Number | 68228-20-6 |
| SMILES | Clc1nc(NCC(O)=O)nc(NC(C)C)n1 |
| InChI | 1S/C8H12ClN5O2/c1-4(2)11-8-13-6(9)12-7(14-8)10-3-5(15)16/h4H,3H2,1-2H3,(H,15,16)(H2,10,11,12,13,14) |
| InChIKey | XCXCBWSRDOSZRU-UHFFFAOYSA-N |
| Density | 1.494g/cm3 (Cal.) |
|---|---|
| Boiling point | 490.343°C at 760 mmHg (Cal.) |
| Flash point | 250.351°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[4-Chloro-6-(isopropylamino)-1,3,5-triazin-2-yl]glycine |