|
CAS#: 68239-08-7 Product: 5,6-Dinitrospiro[1,3-Benzodioxole-2,1'-Cyclohexane] No suppilers available for the product. |
| Name | 5,6-Dinitrospiro[1,3-Benzodioxole-2,1'-Cyclohexane] |
|---|---|
| Synonyms | Spiro(1,3-Benzodioxole-2,1'-Cyclohexane), 5,6-Dinitro-; 5,6-Dinitrospiro(1,3-Benzodioxole-2,1'-Cyclohexane) |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N2O6 |
| Molecular Weight | 280.24 |
| CAS Registry Number | 68239-08-7 |
| EINECS | 269-421-7 |
| SMILES | C1=C([N+]([O-])=O)C(=CC3=C1OC2(CCCCC2)O3)[N+]([O-])=O |
| InChI | 1S/C12H12N2O6/c15-13(16)8-6-10-11(7-9(8)14(17)18)20-12(19-10)4-2-1-3-5-12/h6-7H,1-5H2 |
| InChIKey | FTOUDLLHVRZGEH-UHFFFAOYSA-N |
| Density | 1.5g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.969°C at 760 mmHg (Cal.) |
| Flash point | 211.851°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dinitrospiro[1,3-Benzodioxole-2,1'-Cyclohexane] |