|
CAS#: 68239-80-5 Product: 4-Chlorobenzene-1,3-Diammonium Sulphate No suppilers available for the product. |
| Name | 4-Chlorobenzene-1,3-Diammonium Sulphate |
|---|---|
| Synonyms | (5-Amino-2-Chloro-Phenyl)Amine; Sulfuric Acid; 1,3-Benzenediamine, 4-Chloro-, Sulfate (1:1); 4-Chloro-1,3-Benzenediamine Sulfate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H9ClN2O4S |
| Molecular Weight | 240.66 |
| CAS Registry Number | 68239-80-5 |
| EINECS | 269-474-6 |
| SMILES | O=[S](O)(O)=O.C1=C(C(=CC=C1N)Cl)N |
| InChI | 1S/C6H7ClN2.H2O4S/c7-5-2-1-4(8)3-6(5)9;1-5(2,3)4/h1-3H,8-9H2;(H2,1,2,3,4) |
| InChIKey | MQCUGDYVDRIJAG-UHFFFAOYSA-N |
| Boiling point | 298.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 134.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chlorobenzene-1,3-Diammonium Sulphate |