|
CAS#: 68247-73-4 Product: 3-Methoxy-14,15-Methyleneestra-1,3,5-Triene-17-Ol No suppilers available for the product. |
| Name | 3-Methoxy-14,15-Methyleneestra-1,3,5-Triene-17-Ol |
|---|---|
| Synonyms | 3-Methoxy-14-Beta,15-Beta-Methylen-Estra-1,3,5(10)-Trien-17-Beta-Ol; Sts 593 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.42 |
| CAS Registry Number | 68247-73-4 |
| SMILES | [C@@]345[C@H]2[C@@H](C1=CC=C(OC)C=C1CC2)CC[C@@]3([C@@H](O)C[C@H]4C5)C |
| InChI | 1S/C20H26O2/c1-19-8-7-16-15-5-4-14(22-2)9-12(15)3-6-17(16)20(19)11-13(20)10-18(19)21/h4-5,9,13,16-18,21H,3,6-8,10-11H2,1-2H3/t13-,16+,17+,18-,19+,20+/m0/s1 |
| InChIKey | KWJWXRZFIVSLKX-MLODVTASSA-N |
| Density | 1.193g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.739°C at 760 mmHg (Cal.) |
| Flash point | 201.539°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methoxy-14,15-Methyleneestra-1,3,5-Triene-17-Ol |