| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 1-[5-Methyl-7-(1-Methylethyl)Bicyclo[2.2.2]Oct-5-En-2-Yl]-Ethanone |
|---|---|
| Synonyms | 1-(7-Isopropyl-3-Methyl-6-Bicyclo[2.2.2]Oct-3-Enyl)Ethanone; 1-(5(Or 6)-Methyl-7(Or 8)-(1-Methylethyl)Bicyclo(2.2.2)Oct-5-En-2-Yl)Ethan-1-One; 7- And 8-Acetyl-5-Isopropyl-2-Methylbicyclo(2.2.2)Oct-2-Ene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 |
| CAS Registry Number | 68259-33-6 |
| EINECS | 269-524-7 |
| SMILES | CC1=C2CC(C(C1)C(C2)C(C)C)C(=O)C |
| InChI | 1S/C14H22O/c1-8(2)12-6-11-7-13(10(4)15)14(12)5-9(11)3/h8,12-14H,5-7H2,1-4H3 |
| InChIKey | GNALWRWCIFZYEK-UHFFFAOYSA-N |
| Density | 0.961g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.103°C at 760 mmHg (Cal.) |
| Flash point | 116.923°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[5-Methyl-7-(1-Methylethyl)Bicyclo[2.2.2]Oct-5-En-2-Yl]-Ethanone |