|
CAS#: 68289-70-3 Product: 6-Methoxy-2,3-dimethyl-5-nitro-1H-indole No suppilers available for the product. |
| Name | 6-Methoxy-2,3-dimethyl-5-nitro-1H-indole |
|---|---|
| Synonyms | 6-Methoxy-2,3-dimethyl-5-nitro-1H-indole #; 6-METHOXY-2,3-DIMETHYL-5-NITROINDOLE |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.22 |
| CAS Registry Number | 68289-70-3 |
| SMILES | [O-][N+](=O)c1cc2c(cc1OC)nc(c2C)C |
| InChI | 1S/C11H12N2O3/c1-6-7(2)12-9-5-11(16-3)10(13(14)15)4-8(6)9/h4-5,12H,1-3H3 |
| InChIKey | WNIBLLMFJUFEAS-UHFFFAOYSA-N |
| Density | 1.293g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.076°C at 760 mmHg (Cal.) |
| Flash point | 209.064°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methoxy-2,3-dimethyl-5-nitro-1H-indole |