Online Database of Chemicals from Around the World
|
CAS#: 68298-13-5 Product: 1,1,2,2,3,3,4,4,5,5,5-Undecafluoro-N-Methyl-Pentane-1-Sulfonamide No suppilers available for the product. |
| Name | 1,1,2,2,3,3,4,4,5,5,5-Undecafluoro-N-Methyl-Pentane-1-Sulfonamide |
|---|---|
| Synonyms | 1,1,2,2,3,3,4,4,5,5,5-Undecafluoro-N-Methyl-Pentane-1-Sulfonamide; 1-Pentanesulfonamide, 1,1,2,2,3,3,4,4,5,5,5-Undecafluoro-N-Methyl-; Undecafluoro-N-Methyl-1-Pentanesulfonamide |
| Molecular Structure |  |
| Molecular Formula | C6H4F11NO2S |
| Molecular Weight | 363.15 |
| CAS Registry Number | 68298-13-5 |
| SMILES | CN[S](=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C6H4F11NO2S/c1-18-21(19,20)6(16,17)4(11,12)2(7,8)3(9,10)5(13,14)15/h18H,1H3 |
| InChIKey | BKKNDZBSSSAGIB-UHFFFAOYSA-N |
| Density | 1.669g/cm3 (Cal.) |
|---|---|
| Boiling point | 176.94°C at 760 mmHg (Cal.) |
| Flash point | 60.812°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,2,3,3,4,4,5,5,5-Undecafluoro-N-Methyl-Pentane-1-Sulfonamide |