|
CAS#: 68330-49-4 Product: (1S,6R)-4-Amino-2,5-Dioxo-7-Oxabicyclo[4.1.0]Hept-3-Ene-3-Carboxylic Acid No suppilers available for the product. |
| Name | (1S,6R)-4-Amino-2,5-Dioxo-7-Oxabicyclo[4.1.0]Hept-3-Ene-3-Carboxylic Acid |
|---|---|
| Synonyms | (1S)-4-Amino-2,5-Diketo-7-Oxabicyclo[4.1.0]Hept-3-Ene-3-Carboxylic Acid; 5-18-12-00410 (Beilstein Handbook Reference); Brn 1684305 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H5NO5 |
| Molecular Weight | 183.12 |
| CAS Registry Number | 68330-49-4 |
| SMILES | [C@H]12OC1C(=O)C(=C(C2=O)C(=O)O)N |
| InChI | 1S/C7H5NO5/c8-2-1(7(11)12)3(9)5-6(13-5)4(2)10/h5-6H,8H2,(H,11,12)/t5-,6?/m1/s1 |
| InChIKey | YWEJARDWQNOPAX-LWOQYNTDSA-N |
| Density | 1.862g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.933°C at 760 mmHg (Cal.) |
| Flash point | 181.158°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S,6R)-4-Amino-2,5-Dioxo-7-Oxabicyclo[4.1.0]Hept-3-Ene-3-Carboxylic Acid |