|
CAS#: 68365-90-2 Product: 2,5-Dipropyldecahydroquinoline No suppilers available for the product. |
| Name | 2,5-Dipropyldecahydroquinoline |
|---|---|
| Synonyms | 2,5-Dipropyldecahydroquinoline; 2,5-Dpdhq; Perhydro-Cis-Decahydroquinoline 219A |
| Molecular Structure | ![]() |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 |
| CAS Registry Number | 68365-90-2 |
| SMILES | [C@H]1(N[C@H]2[C@@H](CC1)[C@@H](CCC2)CCC)CCC |
| InChI | 1S/C15H29N/c1-3-6-12-8-5-9-15-14(12)11-10-13(16-15)7-4-2/h12-16H,3-11H2,1-2H3/t12-,13+,14+,15-/m1/s1 |
| InChIKey | MPLWFJRXBSAKCA-CBBWQLFWSA-N |
| Density | 0.851g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.575°C at 760 mmHg (Cal.) |
| Flash point | 133.454°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dipropyldecahydroquinoline |