|
CAS#: 68374-35-6 Product: D-Pindolol No suppilers available for the product. |
| Name | D-Pindolol |
|---|---|
| Synonyms | (2R)-1-(1H-Indol-4-Yloxy)-3-(Isopropylamino)Propan-2-Ol; Pdsp2_001569; Lopac-P-152 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.32 |
| CAS Registry Number | 68374-35-6 |
| SMILES | [C@H](COC1=CC=CC2=C1C=C[NH]2)(CNC(C)C)O |
| InChI | 1S/C14H20N2O2/c1-10(2)16-8-11(17)9-18-14-5-3-4-13-12(14)6-7-15-13/h3-7,10-11,15-17H,8-9H2,1-2H3/t11-/m1/s1 |
| InChIKey | JZQKKSLKJUAGIC-LLVKDONJSA-N |
| Density | 1.152g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.132°C at 760 mmHg (Cal.) |
| Flash point | 230.265°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for D-Pindolol |