|
CAS#: 68398-22-1 Product: Calcium Dimethylhexanoate No suppilers available for the product. |
| Name | Calcium Dimethylhexanoate |
|---|---|
| Synonyms | Calcium Dimethylhexanoate; Hexanoic Acid, Dimethyl-, Calcium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C8H15CaO2 |
| Molecular Weight | 183.29 |
| CAS Registry Number | 68398-22-1 |
| EINECS | 269-973-9 |
| SMILES | C(C(C([O-])=O)(C)C)CCC.[Ca++] |
| InChI | 1S/C8H16O2.Ca/c1-4-5-6-8(2,3)7(9)10;/h4-6H2,1-3H3,(H,9,10);/q;+2/p-1 |
| InChIKey | AMHGHAHIHIODTH-UHFFFAOYSA-M |
| Boiling point | 227.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 102.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Calcium Dimethylhexanoate |