| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 2-Isopropylnaphthalene |
|---|---|
| Synonyms | 2-Isopropylnaphthalene; Fr-0361; Naphthalene, Isopropylated |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 |
| CAS Registry Number | 68442-08-0 |
| SMILES | C1=C(C(C)C)C=CC2=C1C=CC=C2 |
| InChI | 1S/C13H14/c1-10(2)12-8-7-11-5-3-4-6-13(11)9-12/h3-10H,1-2H3 |
| InChIKey | TVYVQNHYIHAJTD-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| 0.975 (Expl.) | |
| Melting point | 14°C (Expl.) |
| Boiling point | 268°C (Expl.) |
| 268.199°C at 760 mmHg (Cal.) | |
| Flash point | 122°C (Expl.) |
| 109.7±8.9°C (Cal.) | |
| Refractive index | 1.587 (Expl.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Isopropylnaphthalene |