|
CAS#: 6848-16-4 Product: 6-Chloro-1,2-Dihydro-2,2,4-Trimethylquinoline No suppilers available for the product. |
| Name | 6-Chloro-1,2-Dihydro-2,2,4-Trimethylquinoline |
|---|---|
| Synonyms | 6-Chloro-1,2-Dihydro-2,2,4-Trimethylquinoline; St5445173 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14ClN |
| Molecular Weight | 207.70 |
| CAS Registry Number | 6848-16-4 |
| EINECS | 229-937-5 |
| SMILES | C1=CC(=CC2=C1NC(C)(C)C=C2C)Cl |
| InChI | 1S/C12H14ClN/c1-8-7-12(2,3)14-11-5-4-9(13)6-10(8)11/h4-7,14H,1-3H3 |
| InChIKey | XQGISKQNLSPHNQ-UHFFFAOYSA-N |
| Density | 1.071g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.048°C at 760 mmHg (Cal.) |
| Flash point | 137.079°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-1,2-Dihydro-2,2,4-Trimethylquinoline |