|
CAS#: 68480-10-4 Product: 3,6,10-Trimethylundeca-3,9-Dien-2-One No suppilers available for the product. |
| Name | 3,6,10-Trimethylundeca-3,9-Dien-2-One |
|---|---|
| Synonyms | 3,6,10-Trimethylundeca-3,9-Dien-2-One; 3,9-Undecadien-2-One, 3,6,10-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 |
| CAS Registry Number | 68480-10-4 (20056-22-8) |
| EINECS | 270-886-3 |
| SMILES | C(\C=C(C(=O)C)/C)C(CCC=C(C)C)C |
| InChI | 1S/C14H24O/c1-11(2)7-6-8-12(3)9-10-13(4)14(5)15/h7,10,12H,6,8-9H2,1-5H3/b13-10+ |
| InChIKey | FJHNHGPWIXCZGA-JLHYYAGUSA-N |
| Density | 0.854g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.227°C at 760 mmHg (Cal.) |
| Flash point | 128.149°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,6,10-Trimethylundeca-3,9-Dien-2-One |