|
CAS#: 6851-44-1 Product: 2,4,5-Trichlorophenetole No suppilers available for the product. |
| Name | 2,4,5-Trichlorophenetole |
|---|---|
| Synonyms | 1,2,4-Trichloro-5-Ethoxy-Benzene; Phenetole, 2,4,5-Trichloro-; Zinc01511369 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7Cl3O |
| Molecular Weight | 225.50 |
| CAS Registry Number | 6851-44-1 |
| EINECS | 229-944-3 |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)OCC |
| InChI | 1S/C8H7Cl3O/c1-2-12-8-4-6(10)5(9)3-7(8)11/h3-4H,2H2,1H3 |
| InChIKey | XMLUZDBYNTZUSI-UHFFFAOYSA-N |
| Density | 1.36g/cm3 (Cal.) |
|---|---|
| Boiling point | 273.301°C at 760 mmHg (Cal.) |
| Flash point | 105.169°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,5-Trichlorophenetole |