|
CAS#: 68517-11-3 Product: 4-[(o-Tolyl)Azo]Xylidine No suppilers available for the product. |
| Name | 4-[(o-Tolyl)Azo]Xylidine |
|---|---|
| Synonyms | 2,6-Dimethyl-4-(2-Methylphenyl)Azo-Aniline; 2,6-Dimethyl-4-(2-Methylphenyl)Azoaniline; [2,6-Dimethyl-4-(2-Methylphenyl)Azo-Phenyl]Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 |
| CAS Registry Number | 68517-11-3 |
| EINECS | 271-191-8 |
| SMILES | C1=C(C(=C(C=C1N=NC2=CC=CC=C2C)C)N)C |
| InChI | 1S/C15H17N3/c1-10-6-4-5-7-14(10)18-17-13-8-11(2)15(16)12(3)9-13/h4-9H,16H2,1-3H3 |
| InChIKey | FTPQHWZPMVGEFA-UHFFFAOYSA-N |
| Density | 1.085g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.935°C at 760 mmHg (Cal.) |
| Flash point | 213.212°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(o-Tolyl)Azo]Xylidine |