|
CAS#: 68540-16-9 Product: Oleandolide No suppilers available for the product. |
| Name | Oleandolide |
|---|---|
| Synonyms | (3R,5S,6S,7R,8S,9R,12R,13R,14S,15R)-6,8,14-Trihydroxy-5,7,9,12,13,15-Hexamethyl-1,11-Dioxaspiro[2.13]Hexadecane-10,16-Quinone; Lmpk01000035; C11990 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H34O7 |
| Molecular Weight | 386.48 |
| CAS Registry Number | 68540-16-9 |
| SMILES | [C@@]12(OC1)C(=O)[C@@H]([C@@H](O)[C@H]([C@H](OC(=O)[C@@H]([C@@H](O)[C@@H]([C@@H](O)[C@H](C2)C)C)C)C)C)C |
| InChI | 1S/C20H34O7/c1-9-7-20(8-26-20)18(24)12(4)16(22)10(2)14(6)27-19(25)13(5)17(23)11(3)15(9)21/h9-17,21-23H,7-8H2,1-6H3/t9-,10-,11+,12+,13+,14+,15-,16-,17-,20+/m0/s1 |
| InChIKey | PFDLUBNRHMFBGI-HRVFELILSA-N |
| Density | 1.193g/cm3 (Cal.) |
|---|---|
| Boiling point | 591.464°C at 760 mmHg (Cal.) |
| Flash point | 203.354°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Oleandolide |