|
CAS#: 6855-99-8 Product: 6,7-Didehydroroyleanone No suppilers available for the product. |
| Name | 6,7-Didehydroroyleanone |
|---|---|
| Synonyms | (4Bs,8As)-1-Hydroxy-2-Isopropyl-4B,8,8-Trimethyl-5,6,7,8A-Tetrahydrophenanthrene-3,4-Dione; (4Bs,8As)-1-Hydroxy-2-Isopropyl-4B,8,8-Trimethyl-5,6,7,8A-Tetrahydrophenanthrene-3,4-Quinone; 1,4-Phenanthrenedione, 4B,5,6,7,8,8A-Hexahydro-3-Hydroxy-4B,8,8-Trimethyl-2-(1-Methylethyl)-, (4Bs-Trans)- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.42 |
| CAS Registry Number | 6855-99-8 |
| SMILES | [C@]12([C@H](C(CCC1)(C)C)C=CC3=C2C(=O)C(=O)C(=C3O)C(C)C)C |
| InChI | 1S/C20H26O3/c1-11(2)14-16(21)12-7-8-13-19(3,4)9-6-10-20(13,5)15(12)18(23)17(14)22/h7-8,11,13,21H,6,9-10H2,1-5H3/t13-,20-/m0/s1 |
| InChIKey | DLSQHYBGHVPMAE-RBZFPXEDSA-N |
| Density | 1.148g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.3°C at 760 mmHg (Cal.) |
| Flash point | 229.991°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Didehydroroyleanone |