|
CAS#: 68555-79-3 Product: Ethyl N-Ethyl-N-[(Undecafluoropentyl)Sulphonyl]Glycinate No suppilers available for the product. |
| Name | Ethyl N-Ethyl-N-[(Undecafluoropentyl)Sulphonyl]Glycinate |
|---|---|
| Synonyms | 2-(Ethyl-(1,1,2,2,3,3,4,4,5,5,5-Undecafluoropentylsulfonyl)Amino)Acetic Acid Ethyl Ester; Ethyl 2-(Ethyl-(1,1,2,2,3,3,4,4,5,5,5-Undecafluoropentylsulfonyl)Amino)Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12F11NO4S |
| Molecular Weight | 463.26 |
| CAS Registry Number | 68555-79-3 |
| EINECS | 271-457-3 |
| SMILES | C(N([S](=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(=O)OCC)C |
| InChI | 1S/C11H12F11NO4S/c1-3-23(5-6(24)27-4-2)28(25,26)11(21,22)9(16,17)7(12,13)8(14,15)10(18,19)20/h3-5H2,1-2H3 |
| InChIKey | YEORWLLYWQFDEW-UHFFFAOYSA-N |
| Density | 1.534g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.122°C at 760 mmHg (Cal.) |
| Flash point | 137.124°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl N-Ethyl-N-[(Undecafluoropentyl)Sulphonyl]Glycinate |