|
CAS#: 685563-26-2 Product: Cyclohexyl 1H-pyrrole-2-carboxylate No suppilers available for the product. |
| Name | Cyclohexyl 1H-pyrrole-2-carboxylate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.24 |
| CAS Registry Number | 685563-26-2 |
| SMILES | c1cc([nH]c1)C(=O)OC2CCCCC2 |
| InChI | 1S/C11H15NO2/c13-11(10-7-4-8-12-10)14-9-5-2-1-3-6-9/h4,7-9,12H,1-3,5-6H2 |
| InChIKey | CXJGILGNNLYKBI-UHFFFAOYSA-N |
| Density | 1.137g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.364°C at 760 mmHg (Cal.) |
| Flash point | 152.39°C (Cal.) |
| Refractive index | 1.535 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cyclohexyl 1H-pyrrole-2-carboxylate |