|
CAS#: 68593-98-6 Product: Pentachlorophenylmercapturic Acid No suppilers available for the product. |
| Name | Pentachlorophenylmercapturic Acid |
|---|---|
| Synonyms | (2R)-2-Acetamido-3-(2,3,4,5,6-Pentachlorophenyl)Sulfanyl-Propanoic Acid; (2R)-2-Acetamido-3-[(2,3,4,5,6-Pentachlorophenyl)Thio]Propanoic Acid; (2R)-2-Acetamido-3-[(2,3,4,5,6-Pentachlorophenyl)Thio]Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8Cl5NO3S |
| Molecular Weight | 411.51 |
| CAS Registry Number | 68593-98-6 |
| SMILES | [C@H](CSC1=C(C(=C(Cl)C(=C1Cl)Cl)Cl)Cl)(C(=O)O)NC(=O)C |
| InChI | 1S/C11H8Cl5NO3S/c1-3(18)17-4(11(19)20)2-21-10-8(15)6(13)5(12)7(14)9(10)16/h4H,2H2,1H3,(H,17,18)(H,19,20)/t4-/m0/s1 |
| InChIKey | CXDOSRKBOPYXSZ-BYPYZUCNSA-N |
| Density | 1.706g/cm3 (Cal.) |
|---|---|
| Boiling point | 575.612°C at 760 mmHg (Cal.) |
| Flash point | 301.92°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pentachlorophenylmercapturic Acid |