|
CAS#: 68616-83-1 Product: Pentamorphone No suppilers available for the product. |
| Name | Pentamorphone |
|---|---|
| Synonyms | A-4492; Morphinan-6-One, 7,8-Didehydro-4,5-Epoxy-3-Hydroxy-17-Methyl-14-(Pentylamino)-, (5Alpha)-; Pentamorphona [Inn-Spanish] |
| Molecular Structure | ![]() |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.47 |
| CAS Registry Number | 68616-83-1 |
| SMILES | [C@]135[C@@]4([C@@H](CC2=C1C(=C(C=C2)O)O[C@H]3C(=O)C=C4)N(C)CC5)NCCCCC |
| InChI | 1S/C22H28N2O3/c1-3-4-5-11-23-22-9-8-16(26)20-21(22)10-12-24(2)17(22)13-14-6-7-15(25)19(27-20)18(14)21/h6-9,17,20,23,25H,3-5,10-13H2,1-2H3/t17-,20+,21+,22-/m1/s1 |
| InChIKey | NRPCWSUJMWEFOK-KDXIVRHGSA-N |
| Density | 1.293g/cm3 (Cal.) |
|---|---|
| Boiling point | 540.863°C at 760 mmHg (Cal.) |
| Flash point | 280.904°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pentamorphone |