|
CAS#: 68647-25-6 Product: 2-(2-Butoxyethoxy)-Ethanol Phosphate Potassium Salt No suppilers available for the product. |
| Name | 2-(2-Butoxyethoxy)-Ethanol Phosphate Potassium Salt |
|---|---|
| Synonyms | Ethanol, 2-(2-Butoxyethoxy)-, Phosphate, Potassium Salt; Butyl Carbitol, Phosphate, Potassium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C8H17K2O6P |
| Molecular Weight | 318.39 |
| CAS Registry Number | 68647-25-6 |
| EINECS | 271-945-6 |
| SMILES | C(O[P]([O-])([O-])=O)COCCOCCCC.[K+].[K+] |
| InChI | 1S/C8H19O6P.2K/c1-2-3-4-12-5-6-13-7-8-14-15(9,10)11;;/h2-8H2,1H3,(H2,9,10,11);;/q;2*+1/p-2 |
| InChIKey | UENYZBITOUAIDL-UHFFFAOYSA-L |
| Boiling point | 373.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 179.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Butoxyethoxy)-Ethanol Phosphate Potassium Salt |