|
CAS#: 68698-61-3 Product: Disodium Pentyl Phosphate No suppilers available for the product. |
| Name | Disodium Pentyl Phosphate |
|---|---|
| Synonyms | Amyl Phosphate; Barium(+2) Cation; Barium Amyl Phosphate; Barium Pentyl Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C5H11BaO4P |
| Molecular Weight | 303.45 |
| CAS Registry Number | 68698-61-3 (34296-07-6) |
| EINECS | 272-090-1 |
| SMILES | C(O[P]([O-])([O-])=O)CCCC.[Ba++] |
| InChI | 1S/C5H13O4P.Ba/c1-2-3-4-5-9-10(6,7)8;/h2-5H2,1H3,(H2,6,7,8);/q;+2/p-2 |
| InChIKey | IPOWAPLRNZJHRJ-UHFFFAOYSA-L |
| Boiling point | 285.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 126.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Disodium Pentyl Phosphate |