|
CAS#: 68738-92-1 Product: 9,13-Dimethyltetradecatetraen-5-One No suppilers available for the product. |
| Name | 9,13-Dimethyltetradecatetraen-5-One |
|---|---|
| Synonyms | 9,13-Dimethyl-1,6,8,12(Or 1,6,9,12)-Tetradecatetraen-5-One; 9,13-Dimethyltetradecatetraen-5-One |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 |
| CAS Registry Number | 68738-92-1 |
| EINECS | 272-118-2 |
| SMILES | C([C](=[C]=[CH]CC(C)C)C)/C=C/C(=O)CCC=C |
| InChI | 1S/C16H24O/c1-5-6-12-16(17)13-8-11-15(4)10-7-9-14(2)3/h5,7-8,13-14H,1,6,9,11-12H2,2-4H3/b13-8+ |
| InChIKey | XZEKFERIIWCRFW-MDWZMJQESA-N |
| Density | 0.858g/cm3 (Cal.) |
|---|---|
| Boiling point | 330.012°C at 760 mmHg (Cal.) |
| Flash point | 146.533°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9,13-Dimethyltetradecatetraen-5-One |