|
CAS#: 68758-79-2 Product: Potassium bis(8-methylnonyl) phosphate No suppilers available for the product. |
| Name | Potassium bis(8-methylnonyl) phosphate |
|---|---|
| Synonyms | Diisodecyl phosphate, potassium salt; Phosphoric acid, diisodecyl ester, potassium salt |
| Molecular Structure | ![]() |
| Molecular Formula | C20H42KO4P |
| Molecular Weight | 416.62 |
| CAS Registry Number | 68758-79-2 |
| SMILES | [K+].[O-]P(=O)(OCCCCCCCC(C)C)OCCCCCCCC(C)C |
| InChI | 1S/C20H43O4P.K/c1-19(2)15-11-7-5-9-13-17-23-25(21,22)24-18-14-10-6-8-12-16-20(3)4;/h19-20H,5-18H2,1-4H3,(H,21,22);/q;+1/p-1 |
| InChIKey | HONUKPLPLZZDIH-UHFFFAOYSA-M |
| Boiling point | 449.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 225.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium bis(8-methylnonyl) phosphate |