|
CAS#: 68779-67-9 Product: Vindeburnol No suppilers available for the product. |
| Name | Vindeburnol |
|---|---|
| Synonyms | (+-)-20,21-Dinor-16Alpha-Eburnamine; Eburnamenin-14-Ol, 14,15-Dihydro-, (3-Alpha,14-Beta)-(+-)-; Ru 24722 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 |
| CAS Registry Number | 68779-67-9 |
| SMILES | [C@@H]5([N]2C1=CC=CC=C1C3=C2[C@H]4N(CC3)CCC[C@@H]4C5)O |
| InChI | 1S/C17H20N2O/c20-15-10-11-4-3-8-18-9-7-13-12-5-1-2-6-14(12)19(15)17(13)16(11)18/h1-2,5-6,11,15-16,20H,3-4,7-10H2/t11-,15-,16+/m1/s1 |
| InChIKey | KOIGYXJOGRVNIS-LYRGGWFBSA-N |
| Density | 1.47g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.495°C at 760 mmHg (Cal.) |
| Flash point | 245.604°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Vindeburnol |