|
CAS#: 68812-80-6 Product: Formaldehyde, polymer with 1,3-benzenediol and methylphenol No suppilers available for the product. |
| Name | Formaldehyde, polymer with 1,3-benzenediol and methylphenol |
|---|---|
| Synonyms | Formaldehyde; 2-Methylphenol; Resorcinol; Benzene-1,3-Diol; Methanal; 2-Methylphenol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 |
| CAS Registry Number | 68812-80-6 |
| SMILES | C1=C(O)C(=CC=C1)C.C2=C(O)C=CC=C2O.O=C |
| InChI | 1S/C7H8O.C6H6O2.CH2O/c1-6-4-2-3-5-7(6)8;7-5-2-1-3-6(8)4-5;1-2/h2-5,8H,1H3;1-4,7-8H;1H2 |
| InChIKey | FQNDNBWHNGPNPN-UHFFFAOYSA-N |
| Boiling point | 191°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 81.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Formaldehyde, polymer with 1,3-benzenediol and methylphenol |