|
CAS#: 68832-48-4 Product: beta-Fluoroaspartic Acid No suppilers available for the product. |
| Name | beta-Fluoroaspartic Acid |
|---|---|
| Synonyms | (2R,3R)-2-Amino-3-Fluoro-Butanedioic Acid; (2R,3R)-2-Amino-3-Fluoro-Succinic Acid; Beta-Fluoroaspartic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C4H6FNO4 |
| Molecular Weight | 151.09 |
| CAS Registry Number | 68832-48-4 |
| SMILES | [C@H](C(O)=O)([C@@H](C(O)=O)N)F |
| InChI | 1S/C4H6FNO4/c5-1(3(7)8)2(6)4(9)10/h1-2H,6H2,(H,7,8)(H,9,10)/t1-,2+/m1/s1 |
| InChIKey | WKTWOKOOUAZXQP-NCGGTJAESA-N |
| Density | 1.613g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.315°C at 760 mmHg (Cal.) |
| Flash point | 125.75°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-Fluoroaspartic Acid |