|
CAS#: 6886-64-2 Product: 2-Fluoranthenebutanoic Acid No suppilers available for the product. |
| Name | 2-Fluoranthenebutanoic Acid |
|---|---|
| Synonyms | 4-(3-Fluoranthenyl)Butanoic Acid; 4-Fluoranthen-3-Ylbutyric Acid; 3-Fluoranthenebutanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16O2 |
| Molecular Weight | 288.35 |
| CAS Registry Number | 6886-64-2 |
| SMILES | C1=CC3=C2C(=C1CCCC(=O)O)C=CC=C2C4=CC=CC=C34 |
| InChI | 1S/C20H16O2/c21-19(22)10-3-5-13-11-12-18-16-7-2-1-6-15(16)17-9-4-8-14(13)20(17)18/h1-2,4,6-9,11-12H,3,5,10H2,(H,21,22) |
| InChIKey | VUUCGMUWSNNVEC-UHFFFAOYSA-N |
| Density | 1.296g/cm3 (Cal.) |
|---|---|
| Boiling point | 515.9°C at 760 mmHg (Cal.) |
| Flash point | 412.333°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Fluoranthenebutanoic Acid |