|
CAS#: 68892-12-6 Product: 2-[[Ethyl(P-Tolyl)Amino]Methyl]Benzenesulphonic Acid No suppilers available for the product. |
| Name | 2-[[Ethyl(P-Tolyl)Amino]Methyl]Benzenesulphonic Acid |
|---|---|
| Synonyms | 2-((Ethyl(P-Tolyl)Amino)Methyl)Benzenesulphonic Acid; 2-(N-Ethyl-N-3-Tolylaminomethyl)Benzenesulfonic Acid; Benzenesulfonic Acid, 2-((Ethyl(3-Methylphenyl)Amino)Methyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.39 |
| CAS Registry Number | 68892-12-6 |
| EINECS | 272-598-3 |
| SMILES | C1=CC=CC(=C1[S](=O)(=O)O)CN(C2=CC(=CC=C2)C)CC |
| InChI | 1S/C16H19NO3S/c1-3-17(15-9-6-7-13(2)11-15)12-14-8-4-5-10-16(14)21(18,19)20/h4-11H,3,12H2,1-2H3,(H,18,19,20) |
| InChIKey | KJGKGAPEKFTEIL-UHFFFAOYSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-[[Ethyl(P-Tolyl)Amino]Methyl]Benzenesulphonic Acid |