Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | All-trans 3-Hydroxyretinol |
|---|---|
| Synonyms | 4-[(1E,3Z,5E,7Z)-9-Hydroxy-3,7-Dimethyl-Nona-1,3,5,7-Tetraenyl]-3,5,5-Trimethyl-Cyclohex-3-En-1-Ol; 4-[(1E,3Z,5E,7Z)-9-Hydroxy-3,7-Dimethylnona-1,3,5,7-Tetraenyl]-3,5,5-Trimethyl-1-Cyclohex-3-Enol; 3-Hydroxyretinol |
| Molecular Structure |  |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 |
| CAS Registry Number | 6890-93-3 |
| SMILES | C(O)/C=C(\C=C\C=C(/C=C/C1=C(CC(O)CC1(C)C)C)C)C |
| InChI | 1S/C20H30O2/c1-15(7-6-8-16(2)11-12-21)9-10-19-17(3)13-18(22)14-20(19,4)5/h6-11,18,21-22H,12-14H2,1-5H3/b8-6+,10-9+,15-7-,16-11- |
| InChIKey | OBODKGDXEIUEIH-SQBKUCFKSA-N |
| Density | 1.018g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.364°C at 760 mmHg (Cal.) |
| Flash point | 205.678°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for All-trans 3-Hydroxyretinol |