|
CAS#: 68921-99-3 Product: 1-(2-Methyl-1-Butenyl)-4-(3-Methylbutoxy)Benzene No suppilers available for the product. |
| Name | 1-(2-Methyl-1-Butenyl)-4-(3-Methylbutoxy)Benzene |
|---|---|
| Synonyms | 1-Isopentyloxy-4-[(E)-2-Methylbut-1-Enyl]Benzene; 1-Isoamoxy-4-[(E)-2-Methylbut-1-Enyl]Benzene; 4-(2-Methylbut-1-Enyl)-1-(3-Methylbutoxy)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 |
| CAS Registry Number | 68921-99-3 |
| SMILES | C1=C(C=CC(=C1)\C=C(\CC)C)OCCC(C)C |
| InChI | 1S/C16H24O/c1-5-14(4)12-15-6-8-16(9-7-15)17-11-10-13(2)3/h6-9,12-13H,5,10-11H2,1-4H3/b14-12+ |
| InChIKey | RJGKXOFFZNQAGM-WYMLVPIESA-N |
| Density | 0.916g/cm3 (Cal.) |
|---|---|
| Boiling point | 329.143°C at 760 mmHg (Cal.) |
| Flash point | 129.795°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Methyl-1-Butenyl)-4-(3-Methylbutoxy)Benzene |