|
CAS#: 68925-98-4 Product: 3-Nitrodibenzothiophene-5-Oxide No suppilers available for the product. |
| Name | 3-Nitrodibenzothiophene-5-Oxide |
|---|---|
| Synonyms | Nsc170578; Ncistruc2_000938; Ncgc00014498 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H7NO3S |
| Molecular Weight | 245.25 |
| CAS Registry Number | 68925-98-4 |
| SMILES | [S]1(=O)C3=C(C2=C1C=CC=C2)C=CC(=C3)[N+]([O-])=O |
| InChI | 1S/C12H7NO3S/c14-13(15)8-5-6-10-9-3-1-2-4-11(9)17(16)12(10)7-8/h1-7H |
| InChIKey | BBSNLPXHXFJCJE-UHFFFAOYSA-N |
| Density | 1.603g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.584°C at 760 mmHg (Cal.) |
| Flash point | 245.053°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Nitrodibenzothiophene-5-Oxide |