CAS#: 68930-68-7 Product: Frenolicin B No suppilers available for the product. |
Name | Frenolicin B |
---|---|
Synonyms | Frenolicin B |
Molecular Structure | ![]() |
Molecular Formula | C18H16O6 |
Molecular Weight | 328.32 |
CAS Registry Number | 68930-68-7 |
SMILES | [C@H]12OC(=O)C[C@H]1O[C@@H](C3=C2C(=O)C4=C(C3=O)C(=CC=C4)O)CCC |
InChI | 1S/C18H16O6/c1-2-4-10-14-15(18-11(23-10)7-12(20)24-18)16(21)8-5-3-6-9(19)13(8)17(14)22/h3,5-6,10-11,18-19H,2,4,7H2,1H3/t10-,11-,18+/m1/s1 |
InChIKey | AVCPRTNVVRPELB-YRUZYCQGSA-N |
Density | 1.46g/cm3 (Cal.) |
---|---|
Boiling point | 621.99°C at 760 mmHg (Cal.) |
Flash point | 232.738°C (Cal.) |
Market Analysis Reports |
List of Reports Available for Frenolicin B |