|
CAS#: 68938-80-7 Product: Dipotassium 3,6-Dichlorosalicylate No suppilers available for the product. |
| Name | Dipotassium 3,6-Dichlorosalicylate |
|---|---|
| Synonyms | Dipotassium 3,6-Dichloro-2-Oxido-Benzoate; Benzoic Acid, 3,6-Dichloro-2-Hydroxy-, Dipotassium Salt; Dipotassium 3,6-Dichlorosalicylate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H2Cl2K2O3 |
| Molecular Weight | 283.19 |
| CAS Registry Number | 68938-80-7 |
| EINECS | 273-146-8 |
| SMILES | C1=C(C(=C(C(=C1)Cl)[O-])C(=O)[O-])Cl.[K+].[K+] |
| InChI | 1S/C7H4Cl2O3.2K/c8-3-1-2-4(9)6(10)5(3)7(11)12;;/h1-2,10H,(H,11,12);;/q;2*+1/p-2 |
| InChIKey | OCBVAAUEJHVUHR-UHFFFAOYSA-L |
| Boiling point | 306.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 139.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dipotassium 3,6-Dichlorosalicylate |